C11H21NO6 — CID 10825422
(1S,2R,3R,6S)-6-amino-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol (PubChem CID 10825422) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is (1S,2R,3R,6S)-6-amino-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2R,3R,6S)-6-amino-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10825422 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (1S,2R,3R,6S)-6-amino-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol |
| SMILES | COCOCC1=C[C@H](N)[C@H](O)[C@@H](O)[C@@H]1OCOC |
| InChI | InChI=1S/C11H21NO6/c1-15-5-17-4-7-3-8(12)9(13)10(14)11(7)18-6-16-2/h3,8-11,13-14H,4-6,12H2,1-2H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | YKPQNXBJQZLNTE-UKKRHICBSA-N |
| XLogP | -1.41 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|