C13H23NO9 — CID 131719637
(1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol;(1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 131719637) has the molecular formula C13H23NO9 and a molecular weight of 337.33 g/mol. Its IUPAC name is (1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol;(1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol;(1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 131719637 |
| Molecular Formula | C13H23NO9 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (1S,2S,3R,6S)-6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol;(1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O.O[C@@H]1[C@@H](O)[C@@H]2OC[C@@H](O2)[C@H]1O |
| InChI | InChI=1S/C7H13NO4.C6H10O5/c8-4-1-3(2-9)5(10)7(12)6(4)11;7-3-2-1-10-6(11-2)5(9)4(3)8/h1,4-7,9-12H,2,8H2;2-9H,1H2/t4-,5+,6-,7-;2-,3-,4+,5-,6-/m01/s1 |
| InChIKey | NCUHEYBNCLNEDT-IYTKCUJHSA-N |
| XLogP | -4.85 |
| TPSA | 186.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -4.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|