C11H19N3O6 — CID 10779773
(1S,2R,3R,6S)-6-azido-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol (PubChem CID 10779773) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (1S,2R,3R,6S)-6-azido-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2R,3R,6S)-6-azido-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10779773 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1S,2R,3R,6S)-6-azido-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclohex-4-ene-1,2-diol |
| SMILES | COCOCC1=C[C@H](N=[N+]=[N-])[C@H](O)[C@@H](O)[C@@H]1OCOC |
| InChI | InChI=1S/C11H19N3O6/c1-17-5-19-4-7-3-8(13-14-12)9(15)10(16)11(7)20-6-18-2/h3,8-11,15-16H,4-6H2,1-2H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | NOTYJSVZVZLHGE-UKKRHICBSA-N |
| XLogP | -0.06 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|