C13H21N3O8 — CID 50916197
(3R,4S,5R,6R)-4-[(1R,4S,5S)-4-azido-5-hydroxy-2-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol (PubChem CID 50916197) has the molecular formula C13H21N3O8 and a molecular weight of 347.32 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-[(1R,4S,5S)-4-azido-5-hydroxy-2-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-4-[(1R,4S,5S)-4-azido-5-hydroxy-2-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 50916197 |
| Molecular Formula | C13H21N3O8 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3R,4S,5R,6R)-4-[(1R,4S,5S)-4-azido-5-hydroxy-2-(hydroxymethyl)cyclohex-2-en-1-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol |
| SMILES | [N-]=[N+]=N[C@H]1C=C(CO)[C@H](O[C@H]2[C@H](O)[C@@H](CO)OC(O)[C@@H]2O)C[C@@H]1O |
| InChI | InChI=1S/C13H21N3O8/c14-16-15-6-1-5(3-17)8(2-7(6)19)23-12-10(20)9(4-18)24-13(22)11(12)21/h1,6-13,17-22H,2-4H2/t6-,7-,8+,9+,10+,11+,12-,13?/m0/s1 |
| InChIKey | MYLLVHIJGNLBQP-IICKCHIISA-N |
| XLogP | -2.47 |
| TPSA | 188.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|