C11H19NO4 — CID 11138928
(3aR,6R,6aS)-4-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine (PubChem CID 11138928) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3aR,6R,6aS)-4-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine.
| Compound Name | (3aR,6R,6aS)-4-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
|---|---|
| PubChem CID | 11138928 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3aR,6R,6aS)-4-(methoxymethoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
| SMILES | COCOCC1=C[C@@H](N)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C11H19NO4/c1-11(2)15-9-7(5-14-6-13-3)4-8(12)10(9)16-11/h4,8-10H,5-6,12H2,1-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | NOHYZYWEYMUXRZ-BBBLOLIVSA-N |
| XLogP | 0.39 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|