C23H38N6O4 — CID 10115651
methyl N-[N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 10115651) has the molecular formula C23H38N6O4 and a molecular weight of 462.60 g/mol. Its IUPAC name is methyl N-[N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | methyl N-[N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 10115651 |
| Molecular Formula | C23H38N6O4 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | methyl N-[N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | COC(=O)N/C(=N\C(CC1CCCCC1)C(=O)NC1(C#N)CCN(C)CC1)N1CCOCC1 |
| InChI | InChI=1S/C23H38N6O4/c1-28-10-8-23(17-24,9-11-28)27-20(30)19(16-18-6-4-3-5-7-18)25-21(26-22(31)32-2)29-12-14-33-15-13-29/h18-19H,3-16H2,1-2H3,(H,27,30)(H,25,26,31) |
| InChIKey | SVOLJUMFERLSGS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|