C24H42N6O4 — CID 10116597
ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-5-methyl-1-oxohexan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 10116597) has the molecular formula C24H42N6O4 and a molecular weight of 478.64 g/mol. Its IUPAC name is ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-5-methyl-1-oxohexan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-5-methyl-1-oxohexan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 10116597 |
| Molecular Formula | C24H42N6O4 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | ethyl N-[N-[(2S)-1-[(4-cyano-1-propylpiperidin-4-yl)amino]-5-methyl-1-oxohexan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCCN1CCC(C#N)(NC(=O)[C@H](CCC(C)C)/N=C(\NC(=O)OCC)N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H42N6O4/c1-5-11-29-12-9-24(18-25,10-13-29)28-21(31)20(8-7-19(3)4)26-22(27-23(32)34-6-2)30-14-16-33-17-15-30/h19-20H,5-17H2,1-4H3,(H,28,31)(H,26,27,32)/t20-/m0/s1 |
| InChIKey | KEKYJNHTWVBSAK-FQEVSTJZSA-N |
| XLogP | 2.11 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|