C16H26O4 — CID 101157402
5-[(E)-dec-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 101157402) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-[(E)-dec-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-dec-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 101157402 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 5-[(E)-dec-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCC/C=C/CCCC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H26O4/c1-4-5-6-7-8-9-10-11-12-13-14(17)19-16(2,3)20-15(13)18/h8-9,13H,4-7,10-12H2,1-3H3/b9-8+ |
| InChIKey | GJIGQOYYQLZUCR-CMDGGOBGSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|