C21H32O6 — CID 139254457
methyl 3-[5-[(2E,7E)-4,4-dimethylnona-2,7-dienyl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate (PubChem CID 139254457) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl 3-[5-[(2E,7E)-4,4-dimethylnona-2,7-dienyl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate.
| Compound Name | methyl 3-[5-[(2E,7E)-4,4-dimethylnona-2,7-dienyl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate |
|---|---|
| PubChem CID | 139254457 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl 3-[5-[(2E,7E)-4,4-dimethylnona-2,7-dienyl]-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate |
| SMILES | C/C=C/CCC(C)(C)/C=C/CC1(CCC(=O)OC)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C21H32O6/c1-7-8-9-12-19(2,3)13-10-14-21(15-11-16(22)25-6)17(23)26-20(4,5)27-18(21)24/h7-8,10,13H,9,11-12,14-15H2,1-6H3/b8-7+,13-10+ |
| InChIKey | LMJVSIWVHRHZIN-AWGJLQHSSA-N |
| XLogP | 4.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|