C28H46O6 — CID 177411662
diethyl 2-[(E)-6-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-2-[(Z)-hex-2-enyl]propanedioate (PubChem CID 177411662) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is diethyl 2-[(E)-6-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-2-[(Z)-hex-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-6-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-2-[(Z)-hex-2-enyl]propanedioate |
|---|---|
| PubChem CID | 177411662 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | diethyl 2-[(E)-6-(2,2-dimethyl-5-prop-2-enyl-1,3-dioxan-5-yl)hex-4-enyl]-2-[(Z)-hex-2-enyl]propanedioate |
| SMILES | C=CCC1(C/C=C/CCCC(C/C=C\CCC)(C(=O)OCC)C(=O)OCC)COC(C)(C)OC1 |
| InChI | InChI=1S/C28H46O6/c1-7-11-12-16-20-28(24(29)31-9-3,25(30)32-10-4)21-17-14-13-15-19-27(18-8-2)22-33-26(5,6)34-23-27/h8,12-13,15-16H,2,7,9-11,14,17-23H2,1,3-6H3/b15-13+,16-12- |
| InChIKey | TVUPXCJWIZWRKR-KJZZRQCISA-N |
| XLogP | 6.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|