C17H30O2 — CID 67260868
2,2-dimethyl-5-[(E)-oct-2-enyl]-5-prop-2-enyl-1,3-dioxane (PubChem CID 67260868) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-oct-2-enyl]-5-prop-2-enyl-1,3-dioxane.
| Compound Name | 2,2-dimethyl-5-[(E)-oct-2-enyl]-5-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 67260868 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-oct-2-enyl]-5-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1(C/C=C/CCCCC)COC(C)(C)OC1 |
| InChI | InChI=1S/C17H30O2/c1-5-7-8-9-10-11-13-17(12-6-2)14-18-16(3,4)19-15-17/h6,10-11H,2,5,7-9,12-15H2,1,3-4H3/b11-10+ |
| InChIKey | ZFPQKEPWAQNMDB-ZHACJKMWSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|