C12H25O3P — CID 101157517
(E)-1-di(propan-2-yloxy)phosphoryl-3,3-dimethylbut-1-ene (PubChem CID 101157517) has the molecular formula C12H25O3P and a molecular weight of 248.30 g/mol. Its IUPAC name is (E)-1-di(propan-2-yloxy)phosphoryl-3,3-dimethylbut-1-ene.
| Compound Name | (E)-1-di(propan-2-yloxy)phosphoryl-3,3-dimethylbut-1-ene |
|---|---|
| PubChem CID | 101157517 |
| Molecular Formula | C12H25O3P |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (E)-1-di(propan-2-yloxy)phosphoryl-3,3-dimethylbut-1-ene |
| SMILES | CC(C)OP(=O)(/C=C/C(C)(C)C)OC(C)C |
| InChI | InChI=1S/C12H25O3P/c1-10(2)14-16(13,15-11(3)4)9-8-12(5,6)7/h8-11H,1-7H3/b9-8+ |
| InChIKey | JBFYEXZOEYVCCW-CMDGGOBGSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|