C10H21O3P — CID 23421664
2-diethoxyphosphoryl-3,3-dimethylbut-1-ene (PubChem CID 23421664) has the molecular formula C10H21O3P and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3,3-dimethylbut-1-ene.
| Compound Name | 2-diethoxyphosphoryl-3,3-dimethylbut-1-ene |
|---|---|
| PubChem CID | 23421664 |
| Molecular Formula | C10H21O3P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-diethoxyphosphoryl-3,3-dimethylbut-1-ene |
| SMILES | C=C(C(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H21O3P/c1-7-12-14(11,13-8-2)9(3)10(4,5)6/h3,7-8H2,1-2,4-6H3 |
| InChIKey | WMIIINLKXMCLJR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|