C11H16INO4 — CID 101160372
methyl (2R,3R,4S)-4-acetyloxy-3-iodo-2-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 101160372) has the molecular formula C11H16INO4 and a molecular weight of 353.16 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-acetyloxy-3-iodo-2-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-acetyloxy-3-iodo-2-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101160372 |
| Molecular Formula | C11H16INO4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | methyl (2R,3R,4S)-4-acetyloxy-3-iodo-2-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@@H](I)[C@@H](OC(C)=O)CN1C(=O)OC |
| InChI | InChI=1S/C11H16INO4/c1-4-5-8-10(12)9(17-7(2)14)6-13(8)11(15)16-3/h4,8-10H,1,5-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | UFWPUXDSDHUFGC-KXUCPTDWSA-N |
| XLogP | 1.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|