C14H21NO4 — CID 11391500
methyl (2S,3S,4R)-4-acetyloxy-2,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate (PubChem CID 11391500) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl (2S,3S,4R)-4-acetyloxy-2,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl (2S,3S,4R)-4-acetyloxy-2,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11391500 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl (2S,3S,4R)-4-acetyloxy-2,3-bis(prop-2-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@@H](OC(C)=O)CN(C(=O)OC)[C@H]1CC=C |
| InChI | InChI=1S/C14H21NO4/c1-5-7-11-12(8-6-2)15(14(17)18-4)9-13(11)19-10(3)16/h5-6,11-13H,1-2,7-9H2,3-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | QWLBLWMLDGCYCR-AVGNSLFASA-N |
| XLogP | 2.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|