C16H24O6 — CID 101161077
(2S,3S,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3,8-dihydroxy-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 101161077) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (2S,3S,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3,8-dihydroxy-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,3S,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3,8-dihydroxy-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 101161077 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (2S,3S,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3,8-dihydroxy-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | O=C1O[C@H]([C@@H]2COC3(CCCCC3)O2)[C@@H](O)C/C=C\C[C@H]1O |
| InChI | InChI=1S/C16H24O6/c17-11-6-2-3-7-12(18)15(19)21-14(11)13-10-20-16(22-13)8-4-1-5-9-16/h2-3,11-14,17-18H,1,4-10H2/b3-2-/t11-,12+,13-,14-/m0/s1 |
| InChIKey | WRDTUFPPJGWHFU-YAQVFCEQSA-N |
| XLogP | 1.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|