C19H32O6Si — CID 101161080
(2S,3R,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-8-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 101161080) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is (2S,3R,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-8-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,3R,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-8-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 101161080 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2S,3R,5Z,8R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-3-hydroxy-8-trimethylsilyloxy-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | C[Si](C)(C)O[C@@H]1C/C=C\C[C@@H](O)[C@@H]([C@@H]2COC3(CCCCC3)O2)OC1=O |
| InChI | InChI=1S/C19H32O6Si/c1-26(2,3)25-15-10-6-5-9-14(20)17(23-18(15)21)16-13-22-19(24-16)11-7-4-8-12-19/h5-6,14-17,20H,4,7-13H2,1-3H3/b6-5-/t14-,15-,16+,17+/m1/s1 |
| InChIKey | WKPSNGJJLIMJLQ-HTPHQWRHSA-N |
| XLogP | 2.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|