About 3-methylideneoctyl phosphono hydrogen phosphate
3-methylideneoctyl phosphono hydrogen phosphate (PubChem CID 101161480) has the molecular formula C9H20O7P2
and a molecular weight of 302.20 g/mol. Its IUPAC name is 3-methylideneoctyl phosphono hydrogen phosphate.
Molecular Properties
| Compound Name | 3-methylideneoctyl phosphono hydrogen phosphate |
| PubChem CID | 101161480 |
| Molecular Formula | C9H20O7P2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-methylideneoctyl phosphono hydrogen phosphate |
| SMILES | C=C(CCCCC)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H20O7P2/c1-3-4-5-6-9(2)7-8-15-18(13,14)16-17(10,11)12/h2-8H2,1H3,(H,13,14)(H2,10,11,12) |
| InChIKey | WANPCSKTQWFLOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneoctyl phosphono hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneoctyl phosphono hydrogen phosphate?
The IUPAC name of 3-methylideneoctyl phosphono hydrogen phosphate (CID 101161480) is 3-methylideneoctyl phosphono hydrogen phosphate.
What is the SMILES notation for 3-methylideneoctyl phosphono hydrogen phosphate?
The canonical SMILES for 3-methylideneoctyl phosphono hydrogen phosphate is C=C(CCCCC)CCOP(=O)(O)OP(=O)(O)O.
What is the InChIKey of 3-methylideneoctyl phosphono hydrogen phosphate?
The InChIKey is WANPCSKTQWFLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O7P2/c1-3-4-5-6-9(2)7-8-15-18(13,14)16-17(10,11)12/h2-8H2,1H3,(H,13,14)(H2,10,11,12).
What are the key properties of 3-methylideneoctyl phosphono hydrogen phosphate?
3-methylideneoctyl phosphono hydrogen phosphate has a molecular weight of 302.20 g/mol, XLogP of 2.74, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneoctyl phosphono hydrogen phosphate is sourced from PubChem (CID 101161480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).