C17H33N2O3P — CID 101163777
methyl (2S)-4-methyl-2-[[methyl-[[(3R)-4-methylpent-1-en-3-yl]amino]phosphoryl]-prop-2-enylamino]pentanoate (PubChem CID 101163777) has the molecular formula C17H33N2O3P and a molecular weight of 344.44 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[[methyl-[[(3R)-4-methylpent-1-en-3-yl]amino]phosphoryl]-prop-2-enylamino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[[methyl-[[(3R)-4-methylpent-1-en-3-yl]amino]phosphoryl]-prop-2-enylamino]pentanoate |
|---|---|
| PubChem CID | 101163777 |
| Molecular Formula | C17H33N2O3P |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | methyl (2S)-4-methyl-2-[[methyl-[[(3R)-4-methylpent-1-en-3-yl]amino]phosphoryl]-prop-2-enylamino]pentanoate |
| SMILES | C=CCN([C@@H](CC(C)C)C(=O)OC)P(C)(=O)N[C@@H](C=C)C(C)C |
| InChI | InChI=1S/C17H33N2O3P/c1-9-11-19(16(12-13(3)4)17(20)22-7)23(8,21)18-15(10-2)14(5)6/h9-10,13-16H,1-2,11-12H2,3-8H3,(H,18,21)/t15-,16-,23?/m0/s1 |
| InChIKey | QAKMIYAXCKBYJK-XCUTYXLRSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|