C18H17N4O3S- — CID 101165609
2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-sulfonate (PubChem CID 101165609) has the molecular formula C18H17N4O3S- and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-sulfonate.
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-sulfonate |
|---|---|
| PubChem CID | 101165609 |
| Molecular Formula | C18H17N4O3S- |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]pyridine-4-sulfonate |
| SMILES | O=S(=O)([O-])c1ccnc(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C18H18N4O3S/c23-26(24,25)18-7-10-21-17(11-18)14-22(12-15-5-1-3-8-19-15)13-16-6-2-4-9-20-16/h1-11H,12-14H2,(H,23,24,25)/p-1 |
| InChIKey | MEMKVCOCPLPIPP-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 99.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|