C19H30N2O — CID 101166696
(Z)-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenylpropan-1-imine (PubChem CID 101166696) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (Z)-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenylpropan-1-imine.
| Compound Name | (Z)-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
|---|---|
| PubChem CID | 101166696 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (Z)-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O/c1-4-19(5-2,22-3)18-14-10-16-21(18)20-15-9-13-17-11-7-6-8-12-17/h6-8,11-12,15,18H,4-5,9-10,13-14,16H2,1-3H3/b20-15-/t18-/m0/s1 |
| InChIKey | XRWCUCHXOAOZPA-BAOGPQIGSA-N |
| XLogP | 4.27 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|