C12H10O6S5 — CID 101167275
dimethyl 2-(5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101167275) has the molecular formula C12H10O6S5 and a molecular weight of 410.54 g/mol. Its IUPAC name is dimethyl 2-(5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101167275 |
| Molecular Formula | C12H10O6S5 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | dimethyl 2-(5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(CS(=O)(=O)C3)S2)S1 |
| InChI | InChI=1S/C12H10O6S5/c1-17-9(13)7-8(10(14)18-2)22-12(21-7)11-19-5-3-23(15,16)4-6(5)20-11/h3-4H2,1-2H3 |
| InChIKey | RGCGWHGAJXIITL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |