C14H12O4S8 — CID 102438761
dimethyl 2-[2-(1,3-dithiolan-2-yl)-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 102438761) has the molecular formula C14H12O4S8 and a molecular weight of 500.78 g/mol. Its IUPAC name is dimethyl 2-[2-(1,3-dithiolan-2-yl)-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-(1,3-dithiolan-2-yl)-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102438761 |
| Molecular Formula | C14H12O4S8 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.85 |
| IUPAC Name | dimethyl 2-[2-(1,3-dithiolan-2-yl)-[1,3]dithiolo[4,5-d][1,3]dithiol-5-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(S2)SC(C2SCCS2)S3)S1 |
| InChI | InChI=1S/C14H12O4S8/c1-17-7(15)5-6(8(16)18-2)22-11(21-5)12-25-13-14(26-12)24-10(23-13)9-19-3-4-20-9/h9-10H,3-4H2,1-2H3 |
| InChIKey | YXVLITSQUOFMLM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |