C54H56BrN3O — CID 101170399
2-[5-(bromomethyl)-2-pyridinyl]-6-[5-[[4-[tris(4-tert-butylphenyl)methyl]phenoxy]methyl]-2-pyridinyl]pyridine (PubChem CID 101170399) has the molecular formula C54H56BrN3O and a molecular weight of 842.97 g/mol. Its IUPAC name is 2-[5-(bromomethyl)-2-pyridinyl]-6-[5-[[4-[tris(4-tert-butylphenyl)methyl]phenoxy]methyl]-2-pyridinyl]pyridine.
| Compound Name | 2-[5-(bromomethyl)-2-pyridinyl]-6-[5-[[4-[tris(4-tert-butylphenyl)methyl]phenoxy]methyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 101170399 |
| Molecular Formula | C54H56BrN3O |
| Molecular Weight | 842.97 g/mol |
| Exact Mass | 841.36 |
| IUPAC Name | 2-[5-(bromomethyl)-2-pyridinyl]-6-[5-[[4-[tris(4-tert-butylphenyl)methyl]phenoxy]methyl]-2-pyridinyl]pyridine |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(OCc3ccc(-c4cccc(-c5ccc(CBr)cn5)n4)nc3)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C54H56BrN3O/c1-51(2,3)39-15-21-42(22-16-39)54(43-23-17-40(18-24-43)52(4,5)6,44-25-19-41(20-26-44)53(7,8)9)45-27-29-46(30-28-45)59-36-38-14-32-48(57-35-38)50-12-10-11-49(58-50)47-31-13-37(33-55)34-56-47/h10-32,34-35H,33,36H2,1-9H3 |
| InChIKey | GEWDOFRFWJPVLQ-UHFFFAOYSA-N |
| XLogP | 13.95 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.97 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|