About [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate
[[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate (PubChem CID 101170410) has the molecular formula C25H27ClN2O7
and a molecular weight of 502.95 g/mol. Its IUPAC name is [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate.
Molecular Properties
| Compound Name | [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate |
| PubChem CID | 101170410 |
| Molecular Formula | C25H27ClN2O7 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate |
| SMILES | CC(C)(C)N(C(=O)c1ccccc1)N(C(=O)OCOC(=O)C1CCOC1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClN2O7/c1-25(2,3)28(22(30)17-7-5-4-6-8-17)27(21(29)18-9-11-20(26)12-10-18)24(32)35-16-34-23(31)19-13-14-33-15-19/h4-12,19H,13-16H2,1-3H3 |
| InChIKey | OJKISSNQTRPCFD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate?
The IUPAC name of [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate (CID 101170410) is [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate.
What is the SMILES notation for [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate?
The canonical SMILES for [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate is CC(C)(C)N(C(=O)c1ccccc1)N(C(=O)OCOC(=O)C1CCOC1)C(=O)c1ccc(Cl)cc1.
What is the InChIKey of [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate?
The InChIKey is OJKISSNQTRPCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27ClN2O7/c1-25(2,3)28(22(30)17-7-5-4-6-8-17)27(21(29)18-9-11-20(26)12-10-18)24(32)35-16-34-23(31)19-13-14-33-15-19/h4-12,19H,13-16H2,1-3H3.
What are the key properties of [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate?
[[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate has a molecular weight of 502.95 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[benzoyl(tert-butyl)amino]-(4-chlorobenzoyl)carbamoyl]oxymethyl oxolane-3-carboxylate is sourced from PubChem (CID 101170410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).