C14H25NO4 — CID 101170599
(3R,7S,7aS)-3-tert-butyl-7-hydroxy-7a-[(1S)-1-hydroxy-2-methylpropyl]-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 101170599) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (3R,7S,7aS)-3-tert-butyl-7-hydroxy-7a-[(1S)-1-hydroxy-2-methylpropyl]-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,7S,7aS)-3-tert-butyl-7-hydroxy-7a-[(1S)-1-hydroxy-2-methylpropyl]-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 101170599 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (3R,7S,7aS)-3-tert-butyl-7-hydroxy-7a-[(1S)-1-hydroxy-2-methylpropyl]-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(C)[C@H](O)[C@@]12CO[C@H](C(C)(C)C)N1C(=O)C[C@@H]2O |
| InChI | InChI=1S/C14H25NO4/c1-8(2)11(18)14-7-19-12(13(3,4)5)15(14)10(17)6-9(14)16/h8-9,11-12,16,18H,6-7H2,1-5H3/t9-,11-,12+,14-/m0/s1 |
| InChIKey | UWQCHHGQVCELIP-ZKCLLBTKSA-N |
| XLogP | 0.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |