C15H25NO6 — CID 10935962
(3R,7aS)-3-tert-butyl-6-hydroperoxy-7a-[(1R)-1-hydroxy-2-methylpropyl]-6-methyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione (PubChem CID 10935962) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3R,7aS)-3-tert-butyl-6-hydroperoxy-7a-[(1R)-1-hydroxy-2-methylpropyl]-6-methyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione.
| Compound Name | (3R,7aS)-3-tert-butyl-6-hydroperoxy-7a-[(1R)-1-hydroxy-2-methylpropyl]-6-methyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 10935962 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (3R,7aS)-3-tert-butyl-6-hydroperoxy-7a-[(1R)-1-hydroxy-2-methylpropyl]-6-methyl-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-5,7-dione |
| SMILES | CC(C)[C@@H](O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)C(C)(OO)C2=O |
| InChI | InChI=1S/C15H25NO6/c1-8(2)9(17)15-7-21-12(13(3,4)5)16(15)11(19)14(6,22-20)10(15)18/h8-9,12,17,20H,7H2,1-6H3/t9-,12-,14?,15+/m1/s1 |
| InChIKey | IVPFRCUDOUXIBG-DALHDNOFSA-N |
| XLogP | 0.80 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|