C17H21NO3S — CID 101171127
methyl (1R,2S,3S,5S)-3-benzoylsulfanyl-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 101171127) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is methyl (1R,2S,3S,5S)-3-benzoylsulfanyl-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,5S)-3-benzoylsulfanyl-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 101171127 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl (1R,2S,3S,5S)-3-benzoylsulfanyl-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](SC(=O)c2ccccc2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C17H21NO3S/c1-18-12-8-9-13(18)15(16(19)21-2)14(10-12)22-17(20)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | PKDHUFYOPRGLEU-LJISPDSOSA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|