C22H40I4Si4 — CID 101171139
[(Z)-iodo-[(2Z,4Z,5Z)-2,4,5-tris[iodo(trimethylsilyl)methylidene]cyclohexylidene]methyl]-trimethylsilane (PubChem CID 101171139) has the molecular formula C22H40I4Si4 and a molecular weight of 924.52 g/mol. Its IUPAC name is [(Z)-iodo-[(2Z,4Z,5Z)-2,4,5-tris[iodo(trimethylsilyl)methylidene]cyclohexylidene]methyl]-trimethylsilane.
| Compound Name | [(Z)-iodo-[(2Z,4Z,5Z)-2,4,5-tris[iodo(trimethylsilyl)methylidene]cyclohexylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 101171139 |
| Molecular Formula | C22H40I4Si4 |
| Molecular Weight | 924.52 g/mol |
| Exact Mass | 923.84 |
| IUPAC Name | [(Z)-iodo-[(2Z,4Z,5Z)-2,4,5-tris[iodo(trimethylsilyl)methylidene]cyclohexylidene]methyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(I)=C1\CC(=C(/I)[Si](C)(C)C)/C(=C(\I)[Si](C)(C)C)C\C1=C(\I)[Si](C)(C)C |
| InChI | InChI=1S/C22H40I4Si4/c1-27(2,3)19(23)15-13-17(21(25)29(7,8)9)18(22(26)30(10,11)12)14-16(15)20(24)28(4,5)6/h13-14H2,1-12H3/b19-15+,20-16+,21-17+,22-18+ |
| InChIKey | JOLGDABYBGLDBE-INFGCDKVSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.52 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|