C18H36I2Si2 — CID 11307531
[(Z,3Z)-2-butyl-1-iodo-3-[iodo(trimethylsilyl)methylidene]hept-1-enyl]-trimethylsilane (PubChem CID 11307531) has the molecular formula C18H36I2Si2 and a molecular weight of 562.47 g/mol. Its IUPAC name is [(Z,3Z)-2-butyl-1-iodo-3-[iodo(trimethylsilyl)methylidene]hept-1-enyl]-trimethylsilane.
| Compound Name | [(Z,3Z)-2-butyl-1-iodo-3-[iodo(trimethylsilyl)methylidene]hept-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11307531 |
| Molecular Formula | C18H36I2Si2 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | [(Z,3Z)-2-butyl-1-iodo-3-[iodo(trimethylsilyl)methylidene]hept-1-enyl]-trimethylsilane |
| SMILES | CCCCC(/C(CCCC)=C(\I)[Si](C)(C)C)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C18H36I2Si2/c1-9-11-13-15(17(19)21(3,4)5)16(14-12-10-2)18(20)22(6,7)8/h9-14H2,1-8H3/b17-15+,18-16+ |
| InChIKey | DKULVYZYOMZSIY-YTEMWHBBSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|