C16H32I2Si2 — CID 177449351
[(E)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]oct-1-enyl]-trimethylsilane (PubChem CID 177449351) has the molecular formula C16H32I2Si2 and a molecular weight of 534.41 g/mol. Its IUPAC name is [(E)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]oct-1-enyl]-trimethylsilane.
| Compound Name | [(E)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]oct-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 177449351 |
| Molecular Formula | C16H32I2Si2 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | [(E)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]oct-1-enyl]-trimethylsilane |
| SMILES | CCCCCCC(/C=C(\I)[Si](C)(C)C)=C(\I)[Si](C)(C)C |
| InChI | InChI=1S/C16H32I2Si2/c1-8-9-10-11-12-14(16(18)20(5,6)7)13-15(17)19(2,3)4/h13H,8-12H2,1-7H3/b15-13+,16-14- |
| InChIKey | UNFZPMJNVZFWQQ-ZNOBWPMYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|