C13H26I2Si2 — CID 11443268
[(Z)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]pent-1-enyl]-trimethylsilane (PubChem CID 11443268) has the molecular formula C13H26I2Si2 and a molecular weight of 492.33 g/mol. Its IUPAC name is [(Z)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]pent-1-enyl]-trimethylsilane.
| Compound Name | [(Z)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]pent-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11443268 |
| Molecular Formula | C13H26I2Si2 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | [(Z)-1-iodo-2-[(Z)-2-iodo-2-trimethylsilylethenyl]pent-1-enyl]-trimethylsilane |
| SMILES | CCCC(/C=C(\I)[Si](C)(C)C)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C13H26I2Si2/c1-8-9-11(13(15)17(5,6)7)10-12(14)16(2,3)4/h10H,8-9H2,1-7H3/b12-10+,13-11+ |
| InChIKey | KKCFCAMNYNKVAK-DCIPZJNNSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|