C13H24I2Si — CID 102328146
[(1Z,3Z)-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane (PubChem CID 102328146) has the molecular formula C13H24I2Si and a molecular weight of 462.23 g/mol. Its IUPAC name is [(1Z,3Z)-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 102328146 |
| Molecular Formula | C13H24I2Si |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | [(1Z,3Z)-1,4-diiodo-3-propylhepta-1,3-dienyl]-trimethylsilane |
| SMILES | CCC/C(I)=C(/C=C(\I)[Si](C)(C)C)CCC |
| InChI | InChI=1S/C13H24I2Si/c1-6-8-11(12(14)9-7-2)10-13(15)16(3,4)5/h10H,6-9H2,1-5H3/b12-11-,13-10+ |
| InChIKey | JMVKVJHKXQMFBJ-QOLBIDBBSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|