C13H21ISi — CID 135038847
[(1E)-3-(cyclohexen-1-yl)-1-iodobuta-1,3-dien-2-yl]-trimethylsilane (PubChem CID 135038847) has the molecular formula C13H21ISi and a molecular weight of 332.30 g/mol. Its IUPAC name is [(1E)-3-(cyclohexen-1-yl)-1-iodobuta-1,3-dien-2-yl]-trimethylsilane.
| Compound Name | [(1E)-3-(cyclohexen-1-yl)-1-iodobuta-1,3-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135038847 |
| Molecular Formula | C13H21ISi |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [(1E)-3-(cyclohexen-1-yl)-1-iodobuta-1,3-dien-2-yl]-trimethylsilane |
| SMILES | C=C(C1=CCCCC1)/C(=C\I)[Si](C)(C)C |
| InChI | InChI=1S/C13H21ISi/c1-11(12-8-6-5-7-9-12)13(10-14)15(2,3)4/h8,10H,1,5-7,9H2,2-4H3/b13-10+ |
| InChIKey | CZXXEPYUTGSDHU-JLHYYAGUSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|