C19H36I2Si — CID 11261306
[(1Z,3Z)-2-hexyl-1,4-diiododeca-1,3-dienyl]-trimethylsilane (PubChem CID 11261306) has the molecular formula C19H36I2Si and a molecular weight of 546.39 g/mol. Its IUPAC name is [(1Z,3Z)-2-hexyl-1,4-diiododeca-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-2-hexyl-1,4-diiododeca-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11261306 |
| Molecular Formula | C19H36I2Si |
| Molecular Weight | 546.39 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | [(1Z,3Z)-2-hexyl-1,4-diiododeca-1,3-dienyl]-trimethylsilane |
| SMILES | CCCCCC/C(I)=C/C(CCCCCC)=C(\I)[Si](C)(C)C |
| InChI | InChI=1S/C19H36I2Si/c1-6-8-10-12-14-17(19(21)22(3,4)5)16-18(20)15-13-11-9-7-2/h16H,6-15H2,1-5H3/b18-16-,19-17+ |
| InChIKey | VPAAXKGDIDGZPW-JQNBNMKOSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.39 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|