C12H24I2Si2 — CID 10695996
[(1Z,3Z)-1,4-diiodo-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane (PubChem CID 10695996) has the molecular formula C12H24I2Si2 and a molecular weight of 478.30 g/mol. Its IUPAC name is [(1Z,3Z)-1,4-diiodo-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-1,4-diiodo-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 10695996 |
| Molecular Formula | C12H24I2Si2 |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | [(1Z,3Z)-1,4-diiodo-2,3-dimethyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane |
| SMILES | CC(/C(C)=C(\I)[Si](C)(C)C)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C12H24I2Si2/c1-9(11(13)15(3,4)5)10(2)12(14)16(6,7)8/h1-8H3/b11-9+,12-10+ |
| InChIKey | SBUWXECKMFYENX-WGDLNXRISA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|