C9H18I2Si — CID 102065771
[(Z)-1,4-diiodo-2-methylpent-1-enyl]-trimethylsilane (PubChem CID 102065771) has the molecular formula C9H18I2Si and a molecular weight of 408.14 g/mol. Its IUPAC name is [(Z)-1,4-diiodo-2-methylpent-1-enyl]-trimethylsilane.
| Compound Name | [(Z)-1,4-diiodo-2-methylpent-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 102065771 |
| Molecular Formula | C9H18I2Si |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | [(Z)-1,4-diiodo-2-methylpent-1-enyl]-trimethylsilane |
| SMILES | C/C(CC(C)I)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C9H18I2Si/c1-7(6-8(2)10)9(11)12(3,4)5/h8H,6H2,1-5H3/b9-7+ |
| InChIKey | FWAXLNSGXHOHLC-VQHVLOKHSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|