C12H20I2Si — CID 15423860
2,5-diiodo-3,4-dimethyl-1,1-di(propan-2-yl)silole (PubChem CID 15423860) has the molecular formula C12H20I2Si and a molecular weight of 446.19 g/mol. Its IUPAC name is 2,5-diiodo-3,4-dimethyl-1,1-di(propan-2-yl)silole.
| Compound Name | 2,5-diiodo-3,4-dimethyl-1,1-di(propan-2-yl)silole |
|---|---|
| PubChem CID | 15423860 |
| Molecular Formula | C12H20I2Si |
| Molecular Weight | 446.19 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | 2,5-diiodo-3,4-dimethyl-1,1-di(propan-2-yl)silole |
| SMILES | CC1=C(I)[Si](C(C)C)(C(C)C)C(I)=C1C |
| InChI | InChI=1S/C12H20I2Si/c1-7(2)15(8(3)4)11(13)9(5)10(6)12(15)14/h7-8H,1-6H3 |
| InChIKey | MOKJGZCRDHHHOU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.19 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|