C11H22I2Si2 — CID 76569429
(1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl)-trimethylsilane (PubChem CID 76569429) has the molecular formula C11H22I2Si2 and a molecular weight of 464.28 g/mol. Its IUPAC name is (1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl)-trimethylsilane.
| Compound Name | (1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 76569429 |
| Molecular Formula | C11H22I2Si2 |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 463.93 |
| IUPAC Name | (1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl)-trimethylsilane |
| SMILES | CC(C=C(I)[Si](C)(C)C)=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C11H22I2Si2/c1-9(11(13)15(5,6)7)8-10(12)14(2,3)4/h8H,1-7H3 |
| InChIKey | KKQHCYRNSTVARV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|