C22H43I3Si4 — CID 162004534
[(1Z,3Z)-1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane;[(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane (PubChem CID 162004534) has the molecular formula C22H43I3Si4 and a molecular weight of 800.64 g/mol. Its IUPAC name is [(1Z,3Z)-1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane;[(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane.
| Compound Name | [(1Z,3Z)-1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane;[(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 162004534 |
| Molecular Formula | C22H43I3Si4 |
| Molecular Weight | 800.64 g/mol |
| Exact Mass | 799.96 |
| IUPAC Name | [(1Z,3Z)-1,4-diiodo-2-methyl-4-trimethylsilylbuta-1,3-dienyl]-trimethylsilane;[(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane |
| SMILES | C/C(C#C[Si](C)(C)C)=C(/I)[Si](C)(C)C.CC(/C=C(\I)[Si](C)(C)C)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C11H22I2Si2.C11H21ISi2/c1-9(11(13)15(5,6)7)8-10(12)14(2,3)4;1-10(8-9-13(2,3)4)11(12)14(5,6)7/h8H,1-7H3;1-7H3/b10-8+,11-9+;11-10+ |
| InChIKey | YSQPDVROBLSBLW-LCSLZCAASA-N |
| XLogP | 10.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.64 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|