C18H38Si4 — CID 11187732
[(1E,3Z)-3,4-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]-trimethylsilane (PubChem CID 11187732) has the molecular formula C18H38Si4 and a molecular weight of 366.85 g/mol. Its IUPAC name is [(1E,3Z)-3,4-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]-trimethylsilane.
| Compound Name | [(1E,3Z)-3,4-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 11187732 |
| Molecular Formula | C18H38Si4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [(1E,3Z)-3,4-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(=C\[Si](C)(C)C)/C(=C/[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H38Si4/c1-19(2,3)14-13-17(15-20(4,5)6)18(22(10,11)12)16-21(7,8)9/h15-16H,1-12H3/b17-15+,18-16- |
| InChIKey | NFHKMDLZLLAOEB-LINYASERSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|