C24H46Si2 — CID 10363007
tri(propan-2-yl)-[4-tri(propan-2-yl)silylhexa-4,5-dien-1-ynyl]silane (PubChem CID 10363007) has the molecular formula C24H46Si2 and a molecular weight of 390.80 g/mol. Its IUPAC name is tri(propan-2-yl)-[4-tri(propan-2-yl)silylhexa-4,5-dien-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[4-tri(propan-2-yl)silylhexa-4,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 10363007 |
| Molecular Formula | C24H46Si2 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | tri(propan-2-yl)-[4-tri(propan-2-yl)silylhexa-4,5-dien-1-ynyl]silane |
| SMILES | C=C=C(CC#C[Si](C(C)C)(C(C)C)C(C)C)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46Si2/c1-14-24(26(21(8)9,22(10)11)23(12)13)16-15-17-25(18(2)3,19(4)5)20(6)7/h18-23H,1,16H2,2-13H3 |
| InChIKey | DNCCBEVZAKFHHL-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|