C12H22Si2 — CID 11775747
trimethyl(4-trimethylsilylhexa-4,5-dien-1-ynyl)silane (PubChem CID 11775747) has the molecular formula C12H22Si2 and a molecular weight of 222.48 g/mol. Its IUPAC name is trimethyl(4-trimethylsilylhexa-4,5-dien-1-ynyl)silane.
| Compound Name | trimethyl(4-trimethylsilylhexa-4,5-dien-1-ynyl)silane |
|---|---|
| PubChem CID | 11775747 |
| Molecular Formula | C12H22Si2 |
| Molecular Weight | 222.48 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | trimethyl(4-trimethylsilylhexa-4,5-dien-1-ynyl)silane |
| SMILES | C=C=C(CC#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H22Si2/c1-8-12(14(5,6)7)10-9-11-13(2,3)4/h1,10H2,2-7H3 |
| InChIKey | HSEABCDYENWEMX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|