C13H28Si3 — CID 13484488
[(E)-1,4-bis(trimethylsilyl)but-1-en-3-yn-2-yl]-trimethylsilane (PubChem CID 13484488) has the molecular formula C13H28Si3 and a molecular weight of 268.62 g/mol. Its IUPAC name is [(E)-1,4-bis(trimethylsilyl)but-1-en-3-yn-2-yl]-trimethylsilane.
| Compound Name | [(E)-1,4-bis(trimethylsilyl)but-1-en-3-yn-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 13484488 |
| Molecular Formula | C13H28Si3 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(E)-1,4-bis(trimethylsilyl)but-1-en-3-yn-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C(=C\[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H28Si3/c1-14(2,3)11-10-13(16(7,8)9)12-15(4,5)6/h12H,1-9H3/b13-12+ |
| InChIKey | UKLDAINLZFHRFH-OUKQBFOZSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|