C15H30Si3 — CID 135062174
trimethyl-[(1Z)-3-trimethylsilyl-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]silane (PubChem CID 135062174) has the molecular formula C15H30Si3 and a molecular weight of 294.66 g/mol. Its IUPAC name is trimethyl-[(1Z)-3-trimethylsilyl-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]silane.
| Compound Name | trimethyl-[(1Z)-3-trimethylsilyl-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 135062174 |
| Molecular Formula | C15H30Si3 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | trimethyl-[(1Z)-3-trimethylsilyl-2-(2-trimethylsilylethynyl)buta-1,3-dienyl]silane |
| SMILES | C=C(/C(C#C[Si](C)(C)C)=C\[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H30Si3/c1-14(18(8,9)10)15(13-17(5,6)7)11-12-16(2,3)4/h13H,1H2,2-10H3/b15-13- |
| InChIKey | RIGKPAYAARGLKJ-SQFISAMPSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|