C16H28Si3 — CID 11779829
trimethyl-[5-trimethylsilyl-3-(2-trimethylsilylethynyl)penta-1,2-dien-4-ynyl]silane (PubChem CID 11779829) has the molecular formula C16H28Si3 and a molecular weight of 304.66 g/mol. Its IUPAC name is trimethyl-[5-trimethylsilyl-3-(2-trimethylsilylethynyl)penta-1,2-dien-4-ynyl]silane.
| Compound Name | trimethyl-[5-trimethylsilyl-3-(2-trimethylsilylethynyl)penta-1,2-dien-4-ynyl]silane |
|---|---|
| PubChem CID | 11779829 |
| Molecular Formula | C16H28Si3 |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | trimethyl-[5-trimethylsilyl-3-(2-trimethylsilylethynyl)penta-1,2-dien-4-ynyl]silane |
| SMILES | C[Si](C)(C)C#CC(=C=C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28Si3/c1-17(2,3)13-10-16(11-14-18(4,5)6)12-15-19(7,8)9/h13H,1-9H3 |
| InChIKey | VSKDJPSBRYPKSN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|