C18H24Si2 — CID 11066401
trimethyl-(5-propan-2-ylidene-9-trimethylsilylnona-1,3,6,8-tetraynyl)silane (PubChem CID 11066401) has the molecular formula C18H24Si2 and a molecular weight of 296.56 g/mol. Its IUPAC name is trimethyl-(5-propan-2-ylidene-9-trimethylsilylnona-1,3,6,8-tetraynyl)silane.
| Compound Name | trimethyl-(5-propan-2-ylidene-9-trimethylsilylnona-1,3,6,8-tetraynyl)silane |
|---|---|
| PubChem CID | 11066401 |
| Molecular Formula | C18H24Si2 |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | trimethyl-(5-propan-2-ylidene-9-trimethylsilylnona-1,3,6,8-tetraynyl)silane |
| SMILES | CC(C)=C(C#CC#C[Si](C)(C)C)C#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H24Si2/c1-17(2)18(13-9-11-15-19(3,4)5)14-10-12-16-20(6,7)8/h1-8H3 |
| InChIKey | VOUFOWQEEFUMMH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|