C28H44Si2 — CID 11373977
[(E)-3,4-diethynyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 11373977) has the molecular formula C28H44Si2 and a molecular weight of 436.83 g/mol. Its IUPAC name is [(E)-3,4-diethynyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(E)-3,4-diethynyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11373977 |
| Molecular Formula | C28H44Si2 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(E)-3,4-diethynyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | C#C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(/C#C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H44Si2/c1-15-27(17-19-29(21(3)4,22(5)6)23(7)8)28(16-2)18-20-30(24(9)10,25(11)12)26(13)14/h1-2,21-26H,3-14H3/b28-27+ |
| InChIKey | REYVQTKHVBATQK-BYYHNAKLSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|