C26H46Si2 — CID 10835624
[3,4-dimethylidene-6-tri(propan-2-yl)silylhexa-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 10835624) has the molecular formula C26H46Si2 and a molecular weight of 414.83 g/mol. Its IUPAC name is [3,4-dimethylidene-6-tri(propan-2-yl)silylhexa-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [3,4-dimethylidene-6-tri(propan-2-yl)silylhexa-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10835624 |
| Molecular Formula | C26H46Si2 |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | [3,4-dimethylidene-6-tri(propan-2-yl)silylhexa-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(=C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H46Si2/c1-19(2)27(20(3)4,21(5)6)17-15-25(13)26(14)16-18-28(22(7)8,23(9)10)24(11)12/h19-24H,13-14H2,1-12H3 |
| InChIKey | CGNCZTLPDABFMZ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|