C30H54Si7 — CID 10930123
[4,4,9,9,14,14-hexamethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]-trimethylsilane (PubChem CID 10930123) has the molecular formula C30H54Si7 and a molecular weight of 611.36 g/mol. Its IUPAC name is [4,4,9,9,14,14-hexamethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]-trimethylsilane.
| Compound Name | [4,4,9,9,14,14-hexamethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10930123 |
| Molecular Formula | C30H54Si7 |
| Molecular Weight | 611.36 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [4,4,9,9,14,14-hexamethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C=C=C([Si](C)(C)C)[Si](C)(C)C#CC2=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C2C#C[Si]1(C)C |
| InChI | InChI=1S/C30H54Si7/c1-31(2,3)27-19-20-28(32(4,5)6)36(15,16)24-22-26-25(21-23-35(27,13)14)29(33(7,8)9)37(17,18)30(26)34(10,11)12/h1-18H3/b28-27- |
| InChIKey | WOEQGYHBIAKWDO-DQSJHHFOSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.36 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|